C21H13ClF4N2O3 — CID 58487385
2-chloro-N-[5-(2,2,3,3-tetrafluoro-7-methyl-1,4-benzodioxin-6-yl)-2-pyridinyl]benzamide (PubChem CID 58487385) has the molecular formula C21H13ClF4N2O3 and a molecular weight of 452.79 g/mol. Its IUPAC name is 2-chloro-N-[5-(2,2,3,3-tetrafluoro-7-methyl-1,4-benzodioxin-6-yl)-2-pyridinyl]benzamide.
| Compound Name | 2-chloro-N-[5-(2,2,3,3-tetrafluoro-7-methyl-1,4-benzodioxin-6-yl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 58487385 |
| Molecular Formula | C21H13ClF4N2O3 |
| Molecular Weight | 452.79 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 2-chloro-N-[5-(2,2,3,3-tetrafluoro-7-methyl-1,4-benzodioxin-6-yl)-2-pyridinyl]benzamide |
| SMILES | Cc1cc2c(cc1-c1ccc(NC(=O)c3ccccc3Cl)nc1)OC(F)(F)C(F)(F)O2 |
| InChI | InChI=1S/C21H13ClF4N2O3/c1-11-8-16-17(31-21(25,26)20(23,24)30-16)9-14(11)12-6-7-18(27-10-12)28-19(29)13-4-2-3-5-15(13)22/h2-10H,1H3,(H,27,28,29) |
| InChIKey | IHXJHVKDWPIUTB-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.79 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|