C23H20F4N4OS — CID 58488245
(2S,3S)-3-amino-4-[[5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-yl]amino]-2-[4-(trifluoromethyl)phenyl]butan-1-ol (PubChem CID 58488245) has the molecular formula C23H20F4N4OS and a molecular weight of 476.50 g/mol. Its IUPAC name is (2S,3S)-3-amino-4-[[5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-yl]amino]-2-[4-(trifluoromethyl)phenyl]butan-1-ol.
| Compound Name | (2S,3S)-3-amino-4-[[5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-yl]amino]-2-[4-(trifluoromethyl)phenyl]butan-1-ol |
|---|---|
| PubChem CID | 58488245 |
| Molecular Formula | C23H20F4N4OS |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | (2S,3S)-3-amino-4-[[5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-yl]amino]-2-[4-(trifluoromethyl)phenyl]butan-1-ol |
| SMILES | N[C@H](CNc1ncc(-c2ccc3cnc(F)cc3c2)s1)[C@@H](CO)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H20F4N4OS/c24-21-8-16-7-14(1-2-15(16)9-29-21)20-11-31-22(33-20)30-10-19(28)18(12-32)13-3-5-17(6-4-13)23(25,26)27/h1-9,11,18-19,32H,10,12,28H2,(H,30,31)/t18-,19+/m0/s1 |
| InChIKey | RQYINAURMKRRKP-RBUKOAKNSA-N |
| XLogP | 5.03 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|