C17H27F3O2Si — CID 58488317
(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-[4-(trifluoromethyl)phenyl]propan-1-ol (PubChem CID 58488317) has the molecular formula C17H27F3O2Si and a molecular weight of 348.48 g/mol. Its IUPAC name is (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-[4-(trifluoromethyl)phenyl]propan-1-ol.
| Compound Name | (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-[4-(trifluoromethyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 58488317 |
| Molecular Formula | C17H27F3O2Si |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-[4-(trifluoromethyl)phenyl]propan-1-ol |
| SMILES | C[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H27F3O2Si/c1-12(11-21)15(22-23(5,6)16(2,3)4)13-7-9-14(10-8-13)17(18,19)20/h7-10,12,15,21H,11H2,1-6H3/t12-,15-/m1/s1 |
| InChIKey | IUNJUHWEAUSFBV-IUODEOHRSA-N |
| XLogP | 5.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|