C35H37Cl2F3N2O2 — CID 58488399
3-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]-2-[6-(2-pentylphenyl)-4-(trifluoromethyl)-3-pyridinyl]propan-1-amine (PubChem CID 58488399) has the molecular formula C35H37Cl2F3N2O2 and a molecular weight of 645.59 g/mol. Its IUPAC name is 3-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]-2-[6-(2-pentylphenyl)-4-(trifluoromethyl)-3-pyridinyl]propan-1-amine.
| Compound Name | 3-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]-2-[6-(2-pentylphenyl)-4-(trifluoromethyl)-3-pyridinyl]propan-1-amine |
|---|---|
| PubChem CID | 58488399 |
| Molecular Formula | C35H37Cl2F3N2O2 |
| Molecular Weight | 645.59 g/mol |
| Exact Mass | 644.22 |
| IUPAC Name | 3-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]-2-[6-(2-pentylphenyl)-4-(trifluoromethyl)-3-pyridinyl]propan-1-amine |
| SMILES | CCCCCc1ccccc1-c1cc(C(F)(F)F)c(C(CN)Cc2ccc(OCCOc3c(Cl)cc(C)cc3Cl)cc2)cn1 |
| InChI | InChI=1S/C35H37Cl2F3N2O2/c1-3-4-5-8-25-9-6-7-10-28(25)33-20-30(35(38,39)40)29(22-42-33)26(21-41)19-24-11-13-27(14-12-24)43-15-16-44-34-31(36)17-23(2)18-32(34)37/h6-7,9-14,17-18,20,22,26H,3-5,8,15-16,19,21,41H2,1-2H3 |
| InChIKey | YNTGBMLEMKFAIA-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.59 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|