About 7-isocyano-1,10-dihydropyrrolo[2,3-a]carbazole-3-carbaldehyde
7-isocyano-1,10-dihydropyrrolo[2,3-a]carbazole-3-carbaldehyde (PubChem CID 58488499) has the molecular formula C16H9N3O
and a molecular weight of 259.27 g/mol. Its IUPAC name is 7-isocyano-1,10-dihydropyrrolo[2,3-a]carbazole-3-carbaldehyde.
Molecular Properties
| Compound Name | 7-isocyano-1,10-dihydropyrrolo[2,3-a]carbazole-3-carbaldehyde |
| PubChem CID | 58488499 |
| Molecular Formula | C16H9N3O |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 7-isocyano-1,10-dihydropyrrolo[2,3-a]carbazole-3-carbaldehyde |
| SMILES | [C-]#[N+]c1ccc2[nH]c3c(ccc4c(C=O)c[nH]c43)c2c1 |
| InChI | InChI=1S/C16H9N3O/c1-17-10-2-5-14-13(6-10)12-4-3-11-9(8-20)7-18-15(11)16(12)19-14/h2-8,18-19H |
| InChIKey | OGTLWZZMADCWDO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 7-isocyano-1,10-dihydropyrrolo[2,3-a]carbazole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-isocyano-1,10-dihydropyrrolo[2,3-a]carbazole-3-carbaldehyde?
The IUPAC name of 7-isocyano-1,10-dihydropyrrolo[2,3-a]carbazole-3-carbaldehyde (CID 58488499) is 7-isocyano-1,10-dihydropyrrolo[2,3-a]carbazole-3-carbaldehyde.
What is the SMILES notation for 7-isocyano-1,10-dihydropyrrolo[2,3-a]carbazole-3-carbaldehyde?
The canonical SMILES for 7-isocyano-1,10-dihydropyrrolo[2,3-a]carbazole-3-carbaldehyde is [C-]#[N+]c1ccc2[nH]c3c(ccc4c(C=O)c[nH]c43)c2c1.
What is the InChIKey of 7-isocyano-1,10-dihydropyrrolo[2,3-a]carbazole-3-carbaldehyde?
The InChIKey is OGTLWZZMADCWDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9N3O/c1-17-10-2-5-14-13(6-10)12-4-3-11-9(8-20)7-18-15(11)16(12)19-14/h2-8,18-19H.
What are the key properties of 7-isocyano-1,10-dihydropyrrolo[2,3-a]carbazole-3-carbaldehyde?
7-isocyano-1,10-dihydropyrrolo[2,3-a]carbazole-3-carbaldehyde has a molecular weight of 259.27 g/mol, XLogP of 4.17, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-isocyano-1,10-dihydropyrrolo[2,3-a]carbazole-3-carbaldehyde is sourced from PubChem (CID 58488499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).