C20H24O4 — CID 58488647
2,11-dimethyl-3,12-dioxatricyclo[13.3.1.16,10]icosa-1(18),6(20),7,9,15(19),16-hexaene-2,11-diol (PubChem CID 58488647) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is 2,11-dimethyl-3,12-dioxatricyclo[13.3.1.16,10]icosa-1(18),6(20),7,9,15(19),16-hexaene-2,11-diol.
| Compound Name | 2,11-dimethyl-3,12-dioxatricyclo[13.3.1.16,10]icosa-1(18),6(20),7,9,15(19),16-hexaene-2,11-diol |
|---|---|
| PubChem CID | 58488647 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 2,11-dimethyl-3,12-dioxatricyclo[13.3.1.16,10]icosa-1(18),6(20),7,9,15(19),16-hexaene-2,11-diol |
| SMILES | CC1(O)OCCc2cccc(c2)C(C)(O)OCCc2cccc1c2 |
| InChI | InChI=1S/C20H24O4/c1-19(21)17-7-3-5-15(13-17)10-12-24-20(2,22)18-8-4-6-16(14-18)9-11-23-19/h3-8,13-14,21-22H,9-12H2,1-2H3 |
| InChIKey | CDQMRJMRBJEDRQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |