C23H26O7 — CID 58488745
2-[(8S,9R)-9-(2-methylpropanoyloxy)-2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl]propan-2-yl (Z)-2-methylbut-2-enoate (PubChem CID 58488745) has the molecular formula C23H26O7 and a molecular weight of 414.45 g/mol. Its IUPAC name is 2-[(8S,9R)-9-(2-methylpropanoyloxy)-2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl]propan-2-yl (Z)-2-methylbut-2-enoate.
| Compound Name | 2-[(8S,9R)-9-(2-methylpropanoyloxy)-2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl]propan-2-yl (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 58488745 |
| Molecular Formula | C23H26O7 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 2-[(8S,9R)-9-(2-methylpropanoyloxy)-2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl]propan-2-yl (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)OC(C)(C)[C@H]1Oc2ccc3ccc(=O)oc3c2[C@H]1OC(=O)C(C)C |
| InChI | InChI=1S/C23H26O7/c1-7-13(4)22(26)30-23(5,6)20-19(29-21(25)12(2)3)17-15(27-20)10-8-14-9-11-16(24)28-18(14)17/h7-12,19-20H,1-6H3/b13-7-/t19-,20+/m1/s1 |
| InChIKey | CBADSRIBFMZVLJ-XTLGIRLXSA-N |
| XLogP | 4.08 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|