C19H9F6N3 — CID 58488812
5-[2-(3,4-diisocyanophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylbenzonitrile (PubChem CID 58488812) has the molecular formula C19H9F6N3 and a molecular weight of 393.29 g/mol. Its IUPAC name is 5-[2-(3,4-diisocyanophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylbenzonitrile.
| Compound Name | 5-[2-(3,4-diisocyanophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylbenzonitrile |
|---|---|
| PubChem CID | 58488812 |
| Molecular Formula | C19H9F6N3 |
| Molecular Weight | 393.29 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 5-[2-(3,4-diisocyanophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylbenzonitrile |
| SMILES | [C-]#[N+]c1ccc(C(c2ccc(C)c(C#N)c2)(C(F)(F)F)C(F)(F)F)cc1[N+]#[C-] |
| InChI | InChI=1S/C19H9F6N3/c1-11-4-5-13(8-12(11)10-26)17(18(20,21)22,19(23,24)25)14-6-7-15(27-2)16(9-14)28-3/h4-9H,1H3 |
| InChIKey | LLAQXXGQAYPXSS-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.29 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|