About 2-[3-[(2S,5S)-5-acetyl-3-oxopiperazin-2-yl]propyl]guanidine
2-[3-[(2S,5S)-5-acetyl-3-oxopiperazin-2-yl]propyl]guanidine (PubChem CID 58488846) has the molecular formula C10H19N5O2
and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-[3-[(2S,5S)-5-acetyl-3-oxopiperazin-2-yl]propyl]guanidine.
Molecular Properties
| Compound Name | 2-[3-[(2S,5S)-5-acetyl-3-oxopiperazin-2-yl]propyl]guanidine |
| PubChem CID | 58488846 |
| Molecular Formula | C10H19N5O2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 2-[3-[(2S,5S)-5-acetyl-3-oxopiperazin-2-yl]propyl]guanidine |
| SMILES | CC(=O)[C@@H]1CN[C@@H](CCCN=C(N)N)C(=O)N1 |
| InChI | InChI=1S/C10H19N5O2/c1-6(16)8-5-14-7(9(17)15-8)3-2-4-13-10(11)12/h7-8,14H,2-5H2,1H3,(H,15,17)(H4,11,12,13)/t7-,8-/m0/s1 |
| InChIKey | SWLJGRYMZOFDGK-YUMQZZPRSA-N |
| XLogP | -1.91 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[(2S,5S)-5-acetyl-3-oxopiperazin-2-yl]propyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[(2S,5S)-5-acetyl-3-oxopiperazin-2-yl]propyl]guanidine?
The IUPAC name of 2-[3-[(2S,5S)-5-acetyl-3-oxopiperazin-2-yl]propyl]guanidine (CID 58488846) is 2-[3-[(2S,5S)-5-acetyl-3-oxopiperazin-2-yl]propyl]guanidine.
What is the SMILES notation for 2-[3-[(2S,5S)-5-acetyl-3-oxopiperazin-2-yl]propyl]guanidine?
The canonical SMILES for 2-[3-[(2S,5S)-5-acetyl-3-oxopiperazin-2-yl]propyl]guanidine is CC(=O)[C@@H]1CN[C@@H](CCCN=C(N)N)C(=O)N1.
What is the InChIKey of 2-[3-[(2S,5S)-5-acetyl-3-oxopiperazin-2-yl]propyl]guanidine?
The InChIKey is SWLJGRYMZOFDGK-YUMQZZPRSA-N. The full InChI is InChI=1S/C10H19N5O2/c1-6(16)8-5-14-7(9(17)15-8)3-2-4-13-10(11)12/h7-8,14H,2-5H2,1H3,(H,15,17)(H4,11,12,13)/t7-,8-/m0/s1.
What are the key properties of 2-[3-[(2S,5S)-5-acetyl-3-oxopiperazin-2-yl]propyl]guanidine?
2-[3-[(2S,5S)-5-acetyl-3-oxopiperazin-2-yl]propyl]guanidine has a molecular weight of 241.29 g/mol, XLogP of -1.91, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[(2S,5S)-5-acetyl-3-oxopiperazin-2-yl]propyl]guanidine is sourced from PubChem (CID 58488846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).