2-cyclopenta-1,3-dien-1-yl-2-hydroxyacetic acid

C7H8O3 — CID 58488944

IUPAC2-cyclopenta-1,3-dien-1-yl-2-hydroxyacetic acid
SMILESO=C(O)C(O)C1=CC=CC1
InChIInChI=1S/C7H8O3/c8-6(7(9)10)5-3-1-2-4-5/h1-3,6,8H,4H2,(H,9,10)
InChIKeyLXYUOAZMQULWHP-UHFFFAOYSA-N
MW140.14 g/mol
LogP0.32
Rot. Bonds2

About 2-cyclopenta-1,3-dien-1-yl-2-hydroxyacetic acid

2-cyclopenta-1,3-dien-1-yl-2-hydroxyacetic acid (PubChem CID 58488944) has the molecular formula C7H8O3 and a molecular weight of 140.14 g/mol. Its IUPAC name is 2-cyclopenta-1,3-dien-1-yl-2-hydroxyacetic acid.

Molecular Properties

Compound Name2-cyclopenta-1,3-dien-1-yl-2-hydroxyacetic acid
PubChem CID58488944
Molecular FormulaC7H8O3
Molecular Weight140.14 g/mol
Exact Mass140.05
IUPAC Name2-cyclopenta-1,3-dien-1-yl-2-hydroxyacetic acid
SMILESO=C(O)C(O)C1=CC=CC1
InChIInChI=1S/C7H8O3/c8-6(7(9)10)5-3-1-2-4-5/h1-3,6,8H,4H2,(H,9,10)
InChIKeyLXYUOAZMQULWHP-UHFFFAOYSA-N
XLogP0.32
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500140.14
LogP ≤ 50.32
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-cyclopenta-1,3-dien-1-yl-2-hydroxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyclopenta-1,3-dien-1-yl-2-hydroxyacetic acid?
The IUPAC name of 2-cyclopenta-1,3-dien-1-yl-2-hydroxyacetic acid (CID 58488944) is 2-cyclopenta-1,3-dien-1-yl-2-hydroxyacetic acid.
What is the SMILES notation for 2-cyclopenta-1,3-dien-1-yl-2-hydroxyacetic acid?
The canonical SMILES for 2-cyclopenta-1,3-dien-1-yl-2-hydroxyacetic acid is O=C(O)C(O)C1=CC=CC1.
What is the InChIKey of 2-cyclopenta-1,3-dien-1-yl-2-hydroxyacetic acid?
The InChIKey is LXYUOAZMQULWHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3/c8-6(7(9)10)5-3-1-2-4-5/h1-3,6,8H,4H2,(H,9,10).
What are the key properties of 2-cyclopenta-1,3-dien-1-yl-2-hydroxyacetic acid?
2-cyclopenta-1,3-dien-1-yl-2-hydroxyacetic acid has a molecular weight of 140.14 g/mol, XLogP of 0.32, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopenta-1,3-dien-1-yl-2-hydroxyacetic acid is sourced from PubChem (CID 58488944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).