About 4-O-(2-hydroxyethyl) 1-O-propyl 2-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]butanedioate
4-O-(2-hydroxyethyl) 1-O-propyl 2-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]butanedioate (PubChem CID 58489280) has the molecular formula C22H25O7P
and a molecular weight of 432.41 g/mol. Its IUPAC name is 4-O-(2-hydroxyethyl) 1-O-propyl 2-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]butanedioate.
Molecular Properties
| Compound Name | 4-O-(2-hydroxyethyl) 1-O-propyl 2-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]butanedioate |
| PubChem CID | 58489280 |
| Molecular Formula | C22H25O7P |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 4-O-(2-hydroxyethyl) 1-O-propyl 2-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]butanedioate |
| SMILES | CCCOC(=O)C(CC(=O)OCCO)CP1(=O)Oc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C22H25O7P/c1-2-12-28-22(25)16(14-21(24)27-13-11-23)15-30(26)20-10-6-4-8-18(20)17-7-3-5-9-19(17)29-30/h3-10,16,23H,2,11-15H2,1H3 |
| InChIKey | MWTDSJSVZJOEDL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-O-(2-hydroxyethyl) 1-O-propyl 2-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-(2-hydroxyethyl) 1-O-propyl 2-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]butanedioate?
The IUPAC name of 4-O-(2-hydroxyethyl) 1-O-propyl 2-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]butanedioate (CID 58489280) is 4-O-(2-hydroxyethyl) 1-O-propyl 2-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]butanedioate.
What is the SMILES notation for 4-O-(2-hydroxyethyl) 1-O-propyl 2-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]butanedioate?
The canonical SMILES for 4-O-(2-hydroxyethyl) 1-O-propyl 2-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]butanedioate is CCCOC(=O)C(CC(=O)OCCO)CP1(=O)Oc2ccccc2-c2ccccc21.
What is the InChIKey of 4-O-(2-hydroxyethyl) 1-O-propyl 2-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]butanedioate?
The InChIKey is MWTDSJSVZJOEDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25O7P/c1-2-12-28-22(25)16(14-21(24)27-13-11-23)15-30(26)20-10-6-4-8-18(20)17-7-3-5-9-19(17)29-30/h3-10,16,23H,2,11-15H2,1H3.
What are the key properties of 4-O-(2-hydroxyethyl) 1-O-propyl 2-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]butanedioate?
4-O-(2-hydroxyethyl) 1-O-propyl 2-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]butanedioate has a molecular weight of 432.41 g/mol, XLogP of 3.14, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-(2-hydroxyethyl) 1-O-propyl 2-[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]butanedioate is sourced from PubChem (CID 58489280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).