About 12H-[1]benzofuro[3,2-a]carbazole
12H-[1]benzofuro[3,2-a]carbazole (PubChem CID 58489692) has the molecular formula C18H11NO
and a molecular weight of 257.29 g/mol. Its IUPAC name is 12H-[1]benzofuro[3,2-a]carbazole.
Molecular Properties
| Compound Name | 12H-[1]benzofuro[3,2-a]carbazole |
| PubChem CID | 58489692 |
| Molecular Formula | C18H11NO |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 12H-[1]benzofuro[3,2-a]carbazole |
| SMILES | c1ccc2c(c1)[nH]c1c2ccc2oc3ccccc3c21 |
| InChI | InChI=1S/C18H11NO/c1-3-7-14-11(5-1)12-9-10-16-17(18(12)19-14)13-6-2-4-8-15(13)20-16/h1-10,19H |
| InChIKey | DERKMBVPWKXOHM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 12H-[1]benzofuro[3,2-a]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12H-[1]benzofuro[3,2-a]carbazole?
The IUPAC name of 12H-[1]benzofuro[3,2-a]carbazole (CID 58489692) is 12H-[1]benzofuro[3,2-a]carbazole.
What is the SMILES notation for 12H-[1]benzofuro[3,2-a]carbazole?
The canonical SMILES for 12H-[1]benzofuro[3,2-a]carbazole is c1ccc2c(c1)[nH]c1c2ccc2oc3ccccc3c21.
What is the InChIKey of 12H-[1]benzofuro[3,2-a]carbazole?
The InChIKey is DERKMBVPWKXOHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11NO/c1-3-7-14-11(5-1)12-9-10-16-17(18(12)19-14)13-6-2-4-8-15(13)20-16/h1-10,19H.
What are the key properties of 12H-[1]benzofuro[3,2-a]carbazole?
12H-[1]benzofuro[3,2-a]carbazole has a molecular weight of 257.29 g/mol, XLogP of 5.22, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 12H-[1]benzofuro[3,2-a]carbazole is sourced from PubChem (CID 58489692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).