About [(E)-(7-methyl-1-oxo-3,4-dihydrophenanthren-2-ylidene)amino] acetate
[(E)-(7-methyl-1-oxo-3,4-dihydrophenanthren-2-ylidene)amino] acetate (PubChem CID 58489988) has the molecular formula C17H15NO3
and a molecular weight of 281.31 g/mol. Its IUPAC name is [(E)-(7-methyl-1-oxo-3,4-dihydrophenanthren-2-ylidene)amino] acetate.
Molecular Properties
| Compound Name | [(E)-(7-methyl-1-oxo-3,4-dihydrophenanthren-2-ylidene)amino] acetate |
| PubChem CID | 58489988 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | [(E)-(7-methyl-1-oxo-3,4-dihydrophenanthren-2-ylidene)amino] acetate |
| SMILES | CC(=O)O/N=C1\CCc2c(ccc3cc(C)ccc23)C1=O |
| InChI | InChI=1S/C17H15NO3/c1-10-3-5-13-12(9-10)4-6-15-14(13)7-8-16(17(15)20)18-21-11(2)19/h3-6,9H,7-8H2,1-2H3/b18-16+ |
| InChIKey | TWVCZTSCADIVSY-FBMGVBCBSA-N |
| XLogP | 3.20 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(7-methyl-1-oxo-3,4-dihydrophenanthren-2-ylidene)amino] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(7-methyl-1-oxo-3,4-dihydrophenanthren-2-ylidene)amino] acetate?
The IUPAC name of [(E)-(7-methyl-1-oxo-3,4-dihydrophenanthren-2-ylidene)amino] acetate (CID 58489988) is [(E)-(7-methyl-1-oxo-3,4-dihydrophenanthren-2-ylidene)amino] acetate.
What is the SMILES notation for [(E)-(7-methyl-1-oxo-3,4-dihydrophenanthren-2-ylidene)amino] acetate?
The canonical SMILES for [(E)-(7-methyl-1-oxo-3,4-dihydrophenanthren-2-ylidene)amino] acetate is CC(=O)O/N=C1\CCc2c(ccc3cc(C)ccc23)C1=O.
What is the InChIKey of [(E)-(7-methyl-1-oxo-3,4-dihydrophenanthren-2-ylidene)amino] acetate?
The InChIKey is TWVCZTSCADIVSY-FBMGVBCBSA-N. The full InChI is InChI=1S/C17H15NO3/c1-10-3-5-13-12(9-10)4-6-15-14(13)7-8-16(17(15)20)18-21-11(2)19/h3-6,9H,7-8H2,1-2H3/b18-16+.
What are the key properties of [(E)-(7-methyl-1-oxo-3,4-dihydrophenanthren-2-ylidene)amino] acetate?
[(E)-(7-methyl-1-oxo-3,4-dihydrophenanthren-2-ylidene)amino] acetate has a molecular weight of 281.31 g/mol, XLogP of 3.20, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(7-methyl-1-oxo-3,4-dihydrophenanthren-2-ylidene)amino] acetate is sourced from PubChem (CID 58489988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).