C31H17F5N2O5 — CID 58490030
[(Z)-[6-ethyl-9-(2-methylbenzoyl)-3-oxofuro[3,2-c]carbazol-2-ylidene]amino] 2,3,4,5,6-pentafluorobenzoate (PubChem CID 58490030) has the molecular formula C31H17F5N2O5 and a molecular weight of 592.48 g/mol. Its IUPAC name is [(Z)-[6-ethyl-9-(2-methylbenzoyl)-3-oxofuro[3,2-c]carbazol-2-ylidene]amino] 2,3,4,5,6-pentafluorobenzoate.
| Compound Name | [(Z)-[6-ethyl-9-(2-methylbenzoyl)-3-oxofuro[3,2-c]carbazol-2-ylidene]amino] 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 58490030 |
| Molecular Formula | C31H17F5N2O5 |
| Molecular Weight | 592.48 g/mol |
| Exact Mass | 592.11 |
| IUPAC Name | [(Z)-[6-ethyl-9-(2-methylbenzoyl)-3-oxofuro[3,2-c]carbazol-2-ylidene]amino] 2,3,4,5,6-pentafluorobenzoate |
| SMILES | CCn1c2ccc(C(=O)c3ccccc3C)cc2c2c3c(ccc21)C(=O)/C(=N/OC(=O)c1c(F)c(F)c(F)c(F)c1F)O3 |
| InChI | InChI=1S/C31H17F5N2O5/c1-3-38-18-10-8-14(27(39)15-7-5-4-6-13(15)2)12-17(18)20-19(38)11-9-16-28(40)30(42-29(16)20)37-43-31(41)21-22(32)24(34)26(36)25(35)23(21)33/h4-12H,3H2,1-2H3/b37-30- |
| InChIKey | STRGJWVMNKAGSE-ONQIKCEGSA-N |
| XLogP | 6.79 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.48 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|