About (2Z)-2-(3,6-dimethyl-10-oxophenanthren-9-ylidene)-2-isocyanoacetonitrile
(2Z)-2-(3,6-dimethyl-10-oxophenanthren-9-ylidene)-2-isocyanoacetonitrile (PubChem CID 58490119) has the molecular formula C19H12N2O
and a molecular weight of 284.32 g/mol. Its IUPAC name is (2Z)-2-(3,6-dimethyl-10-oxophenanthren-9-ylidene)-2-isocyanoacetonitrile.
Molecular Properties
| Compound Name | (2Z)-2-(3,6-dimethyl-10-oxophenanthren-9-ylidene)-2-isocyanoacetonitrile |
| PubChem CID | 58490119 |
| Molecular Formula | C19H12N2O |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | (2Z)-2-(3,6-dimethyl-10-oxophenanthren-9-ylidene)-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1\C(=O)c2ccc(C)cc2-c2cc(C)ccc21 |
| InChI | InChI=1S/C19H12N2O/c1-11-4-6-13-15(8-11)16-9-12(2)5-7-14(16)19(22)18(13)17(10-20)21-3/h4-9H,1-2H3/b18-17- |
| InChIKey | MBOIUJLOUNSLMK-ZCXUNETKSA-N |
| XLogP | 4.32 |
| TPSA | 45.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-(3,6-dimethyl-10-oxophenanthren-9-ylidene)-2-isocyanoacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(3,6-dimethyl-10-oxophenanthren-9-ylidene)-2-isocyanoacetonitrile?
The IUPAC name of (2Z)-2-(3,6-dimethyl-10-oxophenanthren-9-ylidene)-2-isocyanoacetonitrile (CID 58490119) is (2Z)-2-(3,6-dimethyl-10-oxophenanthren-9-ylidene)-2-isocyanoacetonitrile.
What is the SMILES notation for (2Z)-2-(3,6-dimethyl-10-oxophenanthren-9-ylidene)-2-isocyanoacetonitrile?
The canonical SMILES for (2Z)-2-(3,6-dimethyl-10-oxophenanthren-9-ylidene)-2-isocyanoacetonitrile is [C-]#[N+]/C(C#N)=C1\C(=O)c2ccc(C)cc2-c2cc(C)ccc21.
What is the InChIKey of (2Z)-2-(3,6-dimethyl-10-oxophenanthren-9-ylidene)-2-isocyanoacetonitrile?
The InChIKey is MBOIUJLOUNSLMK-ZCXUNETKSA-N. The full InChI is InChI=1S/C19H12N2O/c1-11-4-6-13-15(8-11)16-9-12(2)5-7-14(16)19(22)18(13)17(10-20)21-3/h4-9H,1-2H3/b18-17-.
What are the key properties of (2Z)-2-(3,6-dimethyl-10-oxophenanthren-9-ylidene)-2-isocyanoacetonitrile?
(2Z)-2-(3,6-dimethyl-10-oxophenanthren-9-ylidene)-2-isocyanoacetonitrile has a molecular weight of 284.32 g/mol, XLogP of 4.32, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(3,6-dimethyl-10-oxophenanthren-9-ylidene)-2-isocyanoacetonitrile is sourced from PubChem (CID 58490119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).