C15H18N2O4 — CID 58490135
2,7-dimethyl-5-(1-methyl-2,5-dioxopyrrolidin-3-yl)-3a,4,5,6-tetrahydroisoindole-1,3-dione (PubChem CID 58490135) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2,7-dimethyl-5-(1-methyl-2,5-dioxopyrrolidin-3-yl)-3a,4,5,6-tetrahydroisoindole-1,3-dione.
| Compound Name | 2,7-dimethyl-5-(1-methyl-2,5-dioxopyrrolidin-3-yl)-3a,4,5,6-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 58490135 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2,7-dimethyl-5-(1-methyl-2,5-dioxopyrrolidin-3-yl)-3a,4,5,6-tetrahydroisoindole-1,3-dione |
| SMILES | CC1=C2C(=O)N(C)C(=O)C2CC(C2CC(=O)N(C)C2=O)C1 |
| InChI | InChI=1S/C15H18N2O4/c1-7-4-8(9-6-11(18)16(2)13(9)19)5-10-12(7)15(21)17(3)14(10)20/h8-10H,4-6H2,1-3H3 |
| InChIKey | UGCKQWWDLUAHBS-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|