About [4-(1,2,4,5-tetrazin-3-yl)phenyl]methanol
[4-(1,2,4,5-tetrazin-3-yl)phenyl]methanol (PubChem CID 58490205) has the molecular formula C9H8N4O
and a molecular weight of 188.19 g/mol. Its IUPAC name is [4-(1,2,4,5-tetrazin-3-yl)phenyl]methanol.
Molecular Properties
| Compound Name | [4-(1,2,4,5-tetrazin-3-yl)phenyl]methanol |
| PubChem CID | 58490205 |
| Molecular Formula | C9H8N4O |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | [4-(1,2,4,5-tetrazin-3-yl)phenyl]methanol |
| SMILES | OCc1ccc(-c2nncnn2)cc1 |
| InChI | InChI=1S/C9H8N4O/c14-5-7-1-3-8(4-2-7)9-12-10-6-11-13-9/h1-4,6,14H,5H2 |
| InChIKey | DGAQXVLUQBVTTN-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 71.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(1,2,4,5-tetrazin-3-yl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,2,4,5-tetrazin-3-yl)phenyl]methanol?
The IUPAC name of [4-(1,2,4,5-tetrazin-3-yl)phenyl]methanol (CID 58490205) is [4-(1,2,4,5-tetrazin-3-yl)phenyl]methanol.
What is the SMILES notation for [4-(1,2,4,5-tetrazin-3-yl)phenyl]methanol?
The canonical SMILES for [4-(1,2,4,5-tetrazin-3-yl)phenyl]methanol is OCc1ccc(-c2nncnn2)cc1.
What is the InChIKey of [4-(1,2,4,5-tetrazin-3-yl)phenyl]methanol?
The InChIKey is DGAQXVLUQBVTTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4O/c14-5-7-1-3-8(4-2-7)9-12-10-6-11-13-9/h1-4,6,14H,5H2.
What are the key properties of [4-(1,2,4,5-tetrazin-3-yl)phenyl]methanol?
[4-(1,2,4,5-tetrazin-3-yl)phenyl]methanol has a molecular weight of 188.19 g/mol, XLogP of 0.43, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,2,4,5-tetrazin-3-yl)phenyl]methanol is sourced from PubChem (CID 58490205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).