C19H35NO — CID 58490278
(5Z,9Z)-13-(diethylamino)-6,10-dimethyltrideca-5,9-dien-2-one (PubChem CID 58490278) has the molecular formula C19H35NO and a molecular weight of 293.50 g/mol. Its IUPAC name is (5Z,9Z)-13-(diethylamino)-6,10-dimethyltrideca-5,9-dien-2-one.
| Compound Name | (5Z,9Z)-13-(diethylamino)-6,10-dimethyltrideca-5,9-dien-2-one |
|---|---|
| PubChem CID | 58490278 |
| Molecular Formula | C19H35NO |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.27 |
| IUPAC Name | (5Z,9Z)-13-(diethylamino)-6,10-dimethyltrideca-5,9-dien-2-one |
| SMILES | CCN(CC)CCC/C(C)=C\CC/C(C)=C\CCC(C)=O |
| InChI | InChI=1S/C19H35NO/c1-6-20(7-2)16-10-14-18(4)12-8-11-17(3)13-9-15-19(5)21/h12-13H,6-11,14-16H2,1-5H3/b17-13-,18-12- |
| InChIKey | YRAOZRGKLSMXPD-LTSGFECQSA-N |
| XLogP | 5.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|