About benzyl adamantane-1-carboxylate
benzyl adamantane-1-carboxylate (PubChem CID 584909) has the molecular formula C18H22O2
and a molecular weight of 270.37 g/mol. Its IUPAC name is benzyl adamantane-1-carboxylate.
Molecular Properties
| Compound Name | benzyl adamantane-1-carboxylate |
| PubChem CID | 584909 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | benzyl adamantane-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H22O2/c19-17(20-12-13-4-2-1-3-5-13)18-9-14-6-15(10-18)8-16(7-14)11-18/h1-5,14-16H,6-12H2 |
| InChIKey | VIBYWRCPISSZOY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzyl adamantane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl adamantane-1-carboxylate?
The IUPAC name of benzyl adamantane-1-carboxylate (CID 584909) is benzyl adamantane-1-carboxylate.
What is the SMILES notation for benzyl adamantane-1-carboxylate?
The canonical SMILES for benzyl adamantane-1-carboxylate is O=C(OCc1ccccc1)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of benzyl adamantane-1-carboxylate?
The InChIKey is VIBYWRCPISSZOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O2/c19-17(20-12-13-4-2-1-3-5-13)18-9-14-6-15(10-18)8-16(7-14)11-18/h1-5,14-16H,6-12H2.
What are the key properties of benzyl adamantane-1-carboxylate?
benzyl adamantane-1-carboxylate has a molecular weight of 270.37 g/mol, XLogP of 3.95, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl adamantane-1-carboxylate is sourced from PubChem (CID 584909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).