C23H27F5O5S — CID 58491412
2-[3-[1-(4-ethenylphenoxy)ethoxy]-1-adamantyl]-1,1,3,3,3-pentafluoropropane-1-sulfonic acid (PubChem CID 58491412) has the molecular formula C23H27F5O5S and a molecular weight of 510.52 g/mol. Its IUPAC name is 2-[3-[1-(4-ethenylphenoxy)ethoxy]-1-adamantyl]-1,1,3,3,3-pentafluoropropane-1-sulfonic acid.
| Compound Name | 2-[3-[1-(4-ethenylphenoxy)ethoxy]-1-adamantyl]-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 58491412 |
| Molecular Formula | C23H27F5O5S |
| Molecular Weight | 510.52 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | 2-[3-[1-(4-ethenylphenoxy)ethoxy]-1-adamantyl]-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
| SMILES | C=Cc1ccc(OC(C)OC23CC4CC(C2)CC(C(C(F)(F)F)C(F)(F)S(=O)(=O)O)(C4)C3)cc1 |
| InChI | InChI=1S/C23H27F5O5S/c1-3-15-4-6-18(7-5-15)32-14(2)33-21-11-16-8-17(12-21)10-20(9-16,13-21)19(22(24,25)26)23(27,28)34(29,30)31/h3-7,14,16-17,19H,1,8-13H2,2H3,(H,29,30,31) |
| InChIKey | MGLSLBSQUNYVTF-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.52 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|