C23H26O4 — CID 58491703
(1R,3R,5S,9R,18R)-18-ethyl-1,3,5-trimethyl-6-methylidene-13,17-dioxapentacyclo[10.6.1.02,10.05,9.015,19]nonadeca-2(10),12(19),14-triene-11,16-dione (PubChem CID 58491703) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is (1R,3R,5S,9R,18R)-18-ethyl-1,3,5-trimethyl-6-methylidene-13,17-dioxapentacyclo[10.6.1.02,10.05,9.015,19]nonadeca-2(10),12(19),14-triene-11,16-dione.
| Compound Name | (1R,3R,5S,9R,18R)-18-ethyl-1,3,5-trimethyl-6-methylidene-13,17-dioxapentacyclo[10.6.1.02,10.05,9.015,19]nonadeca-2(10),12(19),14-triene-11,16-dione |
|---|---|
| PubChem CID | 58491703 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | (1R,3R,5S,9R,18R)-18-ethyl-1,3,5-trimethyl-6-methylidene-13,17-dioxapentacyclo[10.6.1.02,10.05,9.015,19]nonadeca-2(10),12(19),14-triene-11,16-dione |
| SMILES | C=C1CC[C@H]2C3=C([C@H](C)C[C@]12C)[C@]1(C)c2c(coc2C3=O)C(=O)O[C@@H]1CC |
| InChI | InChI=1S/C23H26O4/c1-6-15-23(5)17-11(2)9-22(4)12(3)7-8-14(22)16(17)19(24)20-18(23)13(10-26-20)21(25)27-15/h10-11,14-15H,3,6-9H2,1-2,4-5H3/t11-,14+,15-,22-,23-/m1/s1 |
| InChIKey | BMCBEBHOSUMNTH-LKPAGWSPSA-N |
| XLogP | 4.99 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|