C24H28N8O3S2 — CID 58491757
3-[4-[[2-(2-aminopyrimidin-5-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]piperazine-1-carbonyl]thiolan-2-one (PubChem CID 58491757) has the molecular formula C24H28N8O3S2 and a molecular weight of 540.68 g/mol. Its IUPAC name is 3-[4-[[2-(2-aminopyrimidin-5-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]piperazine-1-carbonyl]thiolan-2-one.
| Compound Name | 3-[4-[[2-(2-aminopyrimidin-5-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]piperazine-1-carbonyl]thiolan-2-one |
|---|---|
| PubChem CID | 58491757 |
| Molecular Formula | C24H28N8O3S2 |
| Molecular Weight | 540.68 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | 3-[4-[[2-(2-aminopyrimidin-5-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]piperazine-1-carbonyl]thiolan-2-one |
| SMILES | Nc1ncc(-c2nc(N3CCOCC3)c3sc(CN4CCN(C(=O)C5CCSC5=O)CC4)cc3n2)cn1 |
| InChI | InChI=1S/C24H28N8O3S2/c25-24-26-12-15(13-27-24)20-28-18-11-16(37-19(18)21(29-20)31-6-8-35-9-7-31)14-30-2-4-32(5-3-30)22(33)17-1-10-36-23(17)34/h11-13,17H,1-10,14H2,(H2,25,26,27) |
| InChIKey | SOGJFIDORFCWME-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.68 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|