About N'-ethyl-N'-[3-ethyl-2-hydroxy-6-(methylamino)-5-oxoheptyl]-2-methylbutanehydrazide
N'-ethyl-N'-[3-ethyl-2-hydroxy-6-(methylamino)-5-oxoheptyl]-2-methylbutanehydrazide (PubChem CID 58492176) has the molecular formula C17H35N3O3
and a molecular weight of 329.49 g/mol. Its IUPAC name is N'-ethyl-N'-[3-ethyl-2-hydroxy-6-(methylamino)-5-oxoheptyl]-2-methylbutanehydrazide.
Molecular Properties
| Compound Name | N'-ethyl-N'-[3-ethyl-2-hydroxy-6-(methylamino)-5-oxoheptyl]-2-methylbutanehydrazide |
| PubChem CID | 58492176 |
| Molecular Formula | C17H35N3O3 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.27 |
| IUPAC Name | N'-ethyl-N'-[3-ethyl-2-hydroxy-6-(methylamino)-5-oxoheptyl]-2-methylbutanehydrazide |
| SMILES | CCC(C)C(=O)NN(CC)CC(O)C(CC)CC(=O)C(C)NC |
| InChI | InChI=1S/C17H35N3O3/c1-7-12(4)17(23)19-20(9-3)11-16(22)14(8-2)10-15(21)13(5)18-6/h12-14,16,18,22H,7-11H2,1-6H3,(H,19,23) |
| InChIKey | XGROXZVLMHKCOF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-ethyl-N'-[3-ethyl-2-hydroxy-6-(methylamino)-5-oxoheptyl]-2-methylbutanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N'-[3-ethyl-2-hydroxy-6-(methylamino)-5-oxoheptyl]-2-methylbutanehydrazide?
The IUPAC name of N'-ethyl-N'-[3-ethyl-2-hydroxy-6-(methylamino)-5-oxoheptyl]-2-methylbutanehydrazide (CID 58492176) is N'-ethyl-N'-[3-ethyl-2-hydroxy-6-(methylamino)-5-oxoheptyl]-2-methylbutanehydrazide.
What is the SMILES notation for N'-ethyl-N'-[3-ethyl-2-hydroxy-6-(methylamino)-5-oxoheptyl]-2-methylbutanehydrazide?
The canonical SMILES for N'-ethyl-N'-[3-ethyl-2-hydroxy-6-(methylamino)-5-oxoheptyl]-2-methylbutanehydrazide is CCC(C)C(=O)NN(CC)CC(O)C(CC)CC(=O)C(C)NC.
What is the InChIKey of N'-ethyl-N'-[3-ethyl-2-hydroxy-6-(methylamino)-5-oxoheptyl]-2-methylbutanehydrazide?
The InChIKey is XGROXZVLMHKCOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35N3O3/c1-7-12(4)17(23)19-20(9-3)11-16(22)14(8-2)10-15(21)13(5)18-6/h12-14,16,18,22H,7-11H2,1-6H3,(H,19,23).
What are the key properties of N'-ethyl-N'-[3-ethyl-2-hydroxy-6-(methylamino)-5-oxoheptyl]-2-methylbutanehydrazide?
N'-ethyl-N'-[3-ethyl-2-hydroxy-6-(methylamino)-5-oxoheptyl]-2-methylbutanehydrazide has a molecular weight of 329.49 g/mol, XLogP of 1.34, 12 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N'-[3-ethyl-2-hydroxy-6-(methylamino)-5-oxoheptyl]-2-methylbutanehydrazide is sourced from PubChem (CID 58492176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).