C20H20NO7P — CID 58492367
[7-(4-methoxyphenyl)-5-methyl-6-oxo-2,3-dihydrofuro[3,2-h]quinolin-9-yl]methyl dihydrogen phosphate (PubChem CID 58492367) has the molecular formula C20H20NO7P and a molecular weight of 417.35 g/mol. Its IUPAC name is [7-(4-methoxyphenyl)-5-methyl-6-oxo-2,3-dihydrofuro[3,2-h]quinolin-9-yl]methyl dihydrogen phosphate.
| Compound Name | [7-(4-methoxyphenyl)-5-methyl-6-oxo-2,3-dihydrofuro[3,2-h]quinolin-9-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 58492367 |
| Molecular Formula | C20H20NO7P |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | [7-(4-methoxyphenyl)-5-methyl-6-oxo-2,3-dihydrofuro[3,2-h]quinolin-9-yl]methyl dihydrogen phosphate |
| SMILES | COc1ccc(-c2cn(COP(=O)(O)O)c3c4c(cc(C)c3c2=O)CCO4)cc1 |
| InChI | InChI=1S/C20H20NO7P/c1-12-9-14-7-8-27-20(14)18-17(12)19(22)16(10-21(18)11-28-29(23,24)25)13-3-5-15(26-2)6-4-13/h3-6,9-10H,7-8,11H2,1-2H3,(H2,23,24,25) |
| InChIKey | NSFPQTFSXMIDOU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|