About 1-[5-(methoxymethyl)-2,5-dihydrofuran-2-yl]ethanone
1-[5-(methoxymethyl)-2,5-dihydrofuran-2-yl]ethanone (PubChem CID 58492839) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is 1-[5-(methoxymethyl)-2,5-dihydrofuran-2-yl]ethanone.
Molecular Properties
| Compound Name | 1-[5-(methoxymethyl)-2,5-dihydrofuran-2-yl]ethanone |
| PubChem CID | 58492839 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 1-[5-(methoxymethyl)-2,5-dihydrofuran-2-yl]ethanone |
| SMILES | COCC1C=CC(C(C)=O)O1 |
| InChI | InChI=1S/C8H12O3/c1-6(9)8-4-3-7(11-8)5-10-2/h3-4,7-8H,5H2,1-2H3 |
| InChIKey | OWLMZTIGPAGGKK-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-(methoxymethyl)-2,5-dihydrofuran-2-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(methoxymethyl)-2,5-dihydrofuran-2-yl]ethanone?
The IUPAC name of 1-[5-(methoxymethyl)-2,5-dihydrofuran-2-yl]ethanone (CID 58492839) is 1-[5-(methoxymethyl)-2,5-dihydrofuran-2-yl]ethanone.
What is the SMILES notation for 1-[5-(methoxymethyl)-2,5-dihydrofuran-2-yl]ethanone?
The canonical SMILES for 1-[5-(methoxymethyl)-2,5-dihydrofuran-2-yl]ethanone is COCC1C=CC(C(C)=O)O1.
What is the InChIKey of 1-[5-(methoxymethyl)-2,5-dihydrofuran-2-yl]ethanone?
The InChIKey is OWLMZTIGPAGGKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3/c1-6(9)8-4-3-7(11-8)5-10-2/h3-4,7-8H,5H2,1-2H3.
What are the key properties of 1-[5-(methoxymethyl)-2,5-dihydrofuran-2-yl]ethanone?
1-[5-(methoxymethyl)-2,5-dihydrofuran-2-yl]ethanone has a molecular weight of 156.18 g/mol, XLogP of 0.55, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(methoxymethyl)-2,5-dihydrofuran-2-yl]ethanone is sourced from PubChem (CID 58492839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).