C16H25N3O3 — CID 58492861
(3aS,6R)-6-azido-4-[(2-methylpropan-2-yl)oxymethyl]spiro[6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclohexane] (PubChem CID 58492861) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is (3aS,6R)-6-azido-4-[(2-methylpropan-2-yl)oxymethyl]spiro[6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclohexane].
| Compound Name | (3aS,6R)-6-azido-4-[(2-methylpropan-2-yl)oxymethyl]spiro[6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclohexane] |
|---|---|
| PubChem CID | 58492861 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (3aS,6R)-6-azido-4-[(2-methylpropan-2-yl)oxymethyl]spiro[6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclohexane] |
| SMILES | CC(C)(C)OCC1=C[C@@H](N=[N+]=[N-])C2OC3(CCCCC3)O[C@@H]12 |
| InChI | InChI=1S/C16H25N3O3/c1-15(2,3)20-10-11-9-12(18-19-17)14-13(11)21-16(22-14)7-5-4-6-8-16/h9,12-14H,4-8,10H2,1-3H3/t12-,13+,14?/m1/s1 |
| InChIKey | LCOZTSCASPTIPM-AMIUJLCOSA-N |
| XLogP | 3.86 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|