C11H12FN4O2Y- — CID 58492862
[(2S,5R)-4-fluoro-5-(2-methyl-3,6-dihydro-2H-purin-6-id-9-yl)-2,5-dihydrofuran-2-yl]methanol;yttrium (PubChem CID 58492862) has the molecular formula C11H12FN4O2Y- and a molecular weight of 340.15 g/mol. Its IUPAC name is [(2S,5R)-4-fluoro-5-(2-methyl-3,6-dihydro-2H-purin-6-id-9-yl)-2,5-dihydrofuran-2-yl]methanol;yttrium.
| Compound Name | [(2S,5R)-4-fluoro-5-(2-methyl-3,6-dihydro-2H-purin-6-id-9-yl)-2,5-dihydrofuran-2-yl]methanol;yttrium |
|---|---|
| PubChem CID | 58492862 |
| Molecular Formula | C11H12FN4O2Y- |
| Molecular Weight | 340.15 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | [(2S,5R)-4-fluoro-5-(2-methyl-3,6-dihydro-2H-purin-6-id-9-yl)-2,5-dihydrofuran-2-yl]methanol;yttrium |
| SMILES | CC1N=[C-]c2ncn([C@@H]3O[C@H](CO)C=C3F)c2N1.[Y] |
| InChI | InChI=1S/C11H12FN4O2.Y/c1-6-13-3-9-10(15-6)16(5-14-9)11-8(12)2-7(4-17)18-11;/h2,5-7,11,15,17H,4H2,1H3;/q-1;/t6?,7-,11+;/m0./s1 |
| InChIKey | ZWTBHMKHFINKME-PHIFQMLUSA-N |
| XLogP | 0.69 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.15 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|