About [(5S)-5-(2,2-dimethylpropoxymethyl)-3-fluoro-2,5-dihydrofuran-2-yl] acetate
[(5S)-5-(2,2-dimethylpropoxymethyl)-3-fluoro-2,5-dihydrofuran-2-yl] acetate (PubChem CID 58492893) has the molecular formula C12H19FO4
and a molecular weight of 246.28 g/mol. Its IUPAC name is [(5S)-5-(2,2-dimethylpropoxymethyl)-3-fluoro-2,5-dihydrofuran-2-yl] acetate.
Molecular Properties
| Compound Name | [(5S)-5-(2,2-dimethylpropoxymethyl)-3-fluoro-2,5-dihydrofuran-2-yl] acetate |
| PubChem CID | 58492893 |
| Molecular Formula | C12H19FO4 |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | [(5S)-5-(2,2-dimethylpropoxymethyl)-3-fluoro-2,5-dihydrofuran-2-yl] acetate |
| SMILES | CC(=O)OC1O[C@H](COCC(C)(C)C)C=C1F |
| InChI | InChI=1S/C12H19FO4/c1-8(14)16-11-10(13)5-9(17-11)6-15-7-12(2,3)4/h5,9,11H,6-7H2,1-4H3/t9-,11?/m0/s1 |
| InChIKey | ZSHGKJVQCRJGKR-FTNKSUMCSA-N |
| XLogP | 2.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(5S)-5-(2,2-dimethylpropoxymethyl)-3-fluoro-2,5-dihydrofuran-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5S)-5-(2,2-dimethylpropoxymethyl)-3-fluoro-2,5-dihydrofuran-2-yl] acetate?
The IUPAC name of [(5S)-5-(2,2-dimethylpropoxymethyl)-3-fluoro-2,5-dihydrofuran-2-yl] acetate (CID 58492893) is [(5S)-5-(2,2-dimethylpropoxymethyl)-3-fluoro-2,5-dihydrofuran-2-yl] acetate.
What is the SMILES notation for [(5S)-5-(2,2-dimethylpropoxymethyl)-3-fluoro-2,5-dihydrofuran-2-yl] acetate?
The canonical SMILES for [(5S)-5-(2,2-dimethylpropoxymethyl)-3-fluoro-2,5-dihydrofuran-2-yl] acetate is CC(=O)OC1O[C@H](COCC(C)(C)C)C=C1F.
What is the InChIKey of [(5S)-5-(2,2-dimethylpropoxymethyl)-3-fluoro-2,5-dihydrofuran-2-yl] acetate?
The InChIKey is ZSHGKJVQCRJGKR-FTNKSUMCSA-N. The full InChI is InChI=1S/C12H19FO4/c1-8(14)16-11-10(13)5-9(17-11)6-15-7-12(2,3)4/h5,9,11H,6-7H2,1-4H3/t9-,11?/m0/s1.
What are the key properties of [(5S)-5-(2,2-dimethylpropoxymethyl)-3-fluoro-2,5-dihydrofuran-2-yl] acetate?
[(5S)-5-(2,2-dimethylpropoxymethyl)-3-fluoro-2,5-dihydrofuran-2-yl] acetate has a molecular weight of 246.28 g/mol, XLogP of 2.19, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(5S)-5-(2,2-dimethylpropoxymethyl)-3-fluoro-2,5-dihydrofuran-2-yl] acetate is sourced from PubChem (CID 58492893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).