About 2-[2-[3-(1-propylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate
2-[2-[3-(1-propylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate (PubChem CID 58493015) has the molecular formula C24H44O4S2
and a molecular weight of 460.75 g/mol. Its IUPAC name is 2-[2-[3-(1-propylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate.
Molecular Properties
| Compound Name | 2-[2-[3-(1-propylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate |
| PubChem CID | 58493015 |
| Molecular Formula | C24H44O4S2 |
| Molecular Weight | 460.75 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | 2-[2-[3-(1-propylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate |
| SMILES | CCCC(CCC)C(=O)OCCSSCCOC(=O)CCC1(CCC)CCCCC1 |
| InChI | InChI=1S/C24H44O4S2/c1-4-10-21(11-5-2)23(26)28-18-20-30-29-19-17-27-22(25)12-16-24(13-6-3)14-8-7-9-15-24/h21H,4-20H2,1-3H3 |
| InChIKey | SWSOILOLKFUEJA-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.75 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[3-(1-propylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[3-(1-propylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate?
The IUPAC name of 2-[2-[3-(1-propylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate (CID 58493015) is 2-[2-[3-(1-propylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate.
What is the SMILES notation for 2-[2-[3-(1-propylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate?
The canonical SMILES for 2-[2-[3-(1-propylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate is CCCC(CCC)C(=O)OCCSSCCOC(=O)CCC1(CCC)CCCCC1.
What is the InChIKey of 2-[2-[3-(1-propylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate?
The InChIKey is SWSOILOLKFUEJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H44O4S2/c1-4-10-21(11-5-2)23(26)28-18-20-30-29-19-17-27-22(25)12-16-24(13-6-3)14-8-7-9-15-24/h21H,4-20H2,1-3H3.
What are the key properties of 2-[2-[3-(1-propylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate?
2-[2-[3-(1-propylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate has a molecular weight of 460.75 g/mol, XLogP of 7.20, 17 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[3-(1-propylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate is sourced from PubChem (CID 58493015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).