C9H18N2 — CID 58493123
N,N-dimethyl-3-pyrrolidin-3-ylprop-1-en-2-amine (PubChem CID 58493123) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is N,N-dimethyl-3-pyrrolidin-3-ylprop-1-en-2-amine.
| Compound Name | N,N-dimethyl-3-pyrrolidin-3-ylprop-1-en-2-amine |
|---|---|
| PubChem CID | 58493123 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | N,N-dimethyl-3-pyrrolidin-3-ylprop-1-en-2-amine |
| SMILES | C=C(CC1CCNC1)N(C)C |
| InChI | InChI=1S/C9H18N2/c1-8(11(2)3)6-9-4-5-10-7-9/h9-10H,1,4-7H2,2-3H3 |
| InChIKey | VPJYMGSMWSETJB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |