About CID 58493127
CID 58493127 (PubChem CID 58493127) has the molecular formula C5H9N
and a molecular weight of 83.13 g/mol.
Molecular Properties
| Compound Name | CID 58493127 |
| PubChem CID | 58493127 |
| Molecular Formula | C5H9N |
| Molecular Weight | 83.13 g/mol |
| Exact Mass | 83.07 |
| IUPAC Name | — |
| SMILES | [CH]C(=C)N(C)C |
| InChI | InChI=1S/C5H9N/c1-5(2)6(3)4/h1H,2H2,3-4H3 |
| InChIKey | VJJOGTKPZPRYPK-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 83.13 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 58493127 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58493127?
The IUPAC name of CID 58493127 (CID 58493127) is not available.
What is the SMILES notation for CID 58493127?
The canonical SMILES for CID 58493127 is [CH]C(=C)N(C)C.
What is the InChIKey of CID 58493127?
The InChIKey is VJJOGTKPZPRYPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N/c1-5(2)6(3)4/h1H,2H2,3-4H3.
What are the key properties of CID 58493127?
CID 58493127 has a molecular weight of 83.13 g/mol, XLogP of 0.77, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58493127 is sourced from PubChem (CID 58493127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).