C12H20N2O3S — CID 58493165
4-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-propylbutanamide (PubChem CID 58493165) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is 4-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-propylbutanamide.
| Compound Name | 4-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-propylbutanamide |
|---|---|
| PubChem CID | 58493165 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 4-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-propylbutanamide |
| SMILES | CCCNC(=O)CCCN1C(=O)CC(SC)C1=O |
| InChI | InChI=1S/C12H20N2O3S/c1-3-6-13-10(15)5-4-7-14-11(16)8-9(18-2)12(14)17/h9H,3-8H2,1-2H3,(H,13,15) |
| InChIKey | BQRBOJMPPKCDAV-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|