C17H32N2O — CID 58493290
4,6,7-tritert-butyl-3,5-dihydro-1H-1,4-diazepin-2-one (PubChem CID 58493290) has the molecular formula C17H32N2O and a molecular weight of 280.46 g/mol. Its IUPAC name is 4,6,7-tritert-butyl-3,5-dihydro-1H-1,4-diazepin-2-one.
| Compound Name | 4,6,7-tritert-butyl-3,5-dihydro-1H-1,4-diazepin-2-one |
|---|---|
| PubChem CID | 58493290 |
| Molecular Formula | C17H32N2O |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.25 |
| IUPAC Name | 4,6,7-tritert-butyl-3,5-dihydro-1H-1,4-diazepin-2-one |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)NC(=O)CN(C(C)(C)C)C1 |
| InChI | InChI=1S/C17H32N2O/c1-15(2,3)12-10-19(17(7,8)9)11-13(20)18-14(12)16(4,5)6/h10-11H2,1-9H3,(H,18,20) |
| InChIKey | JBXARISPACXQHY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |