C25H40BNO4 — CID 58494167
ethyl 4-[4-[2-ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-1-yl]butanoate (PubChem CID 58494167) has the molecular formula C25H40BNO4 and a molecular weight of 429.41 g/mol. Its IUPAC name is ethyl 4-[4-[2-ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-1-yl]butanoate.
| Compound Name | ethyl 4-[4-[2-ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-1-yl]butanoate |
|---|---|
| PubChem CID | 58494167 |
| Molecular Formula | C25H40BNO4 |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 429.31 |
| IUPAC Name | ethyl 4-[4-[2-ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-1-yl]butanoate |
| SMILES | CCOC(=O)CCCN1CCC(c2cccc(B3OC(C)(C)C(C)(C)O3)c2CC)CC1 |
| InChI | InChI=1S/C25H40BNO4/c1-7-20-21(11-9-12-22(20)26-30-24(3,4)25(5,6)31-26)19-14-17-27(18-15-19)16-10-13-23(28)29-8-2/h9,11-12,19H,7-8,10,13-18H2,1-6H3 |
| InChIKey | LXKSBNCMHAJTNJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|