C20H21FN6O2 — CID 58494454
2-[(4-fluorophenyl)-(2-methoxyethoxy)methyl]-N-(5-methyl-1H-pyrazol-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 58494454) has the molecular formula C20H21FN6O2 and a molecular weight of 396.43 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)-(2-methoxyethoxy)methyl]-N-(5-methyl-1H-pyrazol-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 2-[(4-fluorophenyl)-(2-methoxyethoxy)methyl]-N-(5-methyl-1H-pyrazol-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 58494454 |
| Molecular Formula | C20H21FN6O2 |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 2-[(4-fluorophenyl)-(2-methoxyethoxy)methyl]-N-(5-methyl-1H-pyrazol-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | COCCOC(c1ccc(F)cc1)c1nc(Nc2cc(C)[nH]n2)c2cccn2n1 |
| InChI | InChI=1S/C20H21FN6O2/c1-13-12-17(25-24-13)22-19-16-4-3-9-27(16)26-20(23-19)18(29-11-10-28-2)14-5-7-15(21)8-6-14/h3-9,12,18H,10-11H2,1-2H3,(H2,22,23,24,25,26) |
| InChIKey | VIKSIDKFTNLKTF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|