C21H33N3O2 — CID 58494682
4-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]-5-methyl-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine (PubChem CID 58494682) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is 4-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]-5-methyl-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine.
| Compound Name | 4-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]-5-methyl-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine |
|---|---|
| PubChem CID | 58494682 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | 4-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]-5-methyl-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine |
| SMILES | Cc1c2c(cc3c1N(CCN1C[C@@H](C)O[C@@H](C)C1)CCO3)CCNCC2 |
| InChI | InChI=1S/C21H33N3O2/c1-15-13-23(14-16(2)26-15)8-9-24-10-11-25-20-12-18-4-6-22-7-5-19(18)17(3)21(20)24/h12,15-16,22H,4-11,13-14H2,1-3H3/t15-,16+ |
| InChIKey | BPENVPRTHRTAKD-IYBDPMFKSA-N |
| XLogP | 1.99 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |