C15H22N2 — CID 58494720
1,11-dimethyl-2,3,4,6,7,8,9,10-octahydropyrido[3,2-h][3]benzazepine (PubChem CID 58494720) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 1,11-dimethyl-2,3,4,6,7,8,9,10-octahydropyrido[3,2-h][3]benzazepine.
| Compound Name | 1,11-dimethyl-2,3,4,6,7,8,9,10-octahydropyrido[3,2-h][3]benzazepine |
|---|---|
| PubChem CID | 58494720 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1,11-dimethyl-2,3,4,6,7,8,9,10-octahydropyrido[3,2-h][3]benzazepine |
| SMILES | Cc1c2c(cc3c1N(C)CCC3)CCNCC2 |
| InChI | InChI=1S/C15H22N2/c1-11-14-6-8-16-7-5-12(14)10-13-4-3-9-17(2)15(11)13/h10,16H,3-9H2,1-2H3 |
| InChIKey | HIVUEECVARYZDY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |