C19H24N4O2 — CID 58494795
5-methyl-4-(2-pyrimidin-2-yloxyethyl)-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine (PubChem CID 58494795) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 5-methyl-4-(2-pyrimidin-2-yloxyethyl)-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine.
| Compound Name | 5-methyl-4-(2-pyrimidin-2-yloxyethyl)-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine |
|---|---|
| PubChem CID | 58494795 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 5-methyl-4-(2-pyrimidin-2-yloxyethyl)-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine |
| SMILES | Cc1c2c(cc3c1N(CCOc1ncccn1)CCO3)CCNCC2 |
| InChI | InChI=1S/C19H24N4O2/c1-14-16-4-8-20-7-3-15(16)13-17-18(14)23(9-11-24-17)10-12-25-19-21-5-2-6-22-19/h2,5-6,13,20H,3-4,7-12H2,1H3 |
| InChIKey | AXSOKGDHFATTHI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |