C15H21FN2O — CID 58494893
4-[(2R)-2-fluoropropyl]-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine (PubChem CID 58494893) has the molecular formula C15H21FN2O and a molecular weight of 264.34 g/mol. Its IUPAC name is 4-[(2R)-2-fluoropropyl]-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine.
| Compound Name | 4-[(2R)-2-fluoropropyl]-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine |
|---|---|
| PubChem CID | 58494893 |
| Molecular Formula | C15H21FN2O |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 4-[(2R)-2-fluoropropyl]-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine |
| SMILES | C[C@@H](F)CN1CCOc2cc3c(cc21)CCNCC3 |
| InChI | InChI=1S/C15H21FN2O/c1-11(16)10-18-6-7-19-15-9-13-3-5-17-4-2-12(13)8-14(15)18/h8-9,11,17H,2-7,10H2,1H3/t11-/m1/s1 |
| InChIKey | JMMSBQNDDMQAOV-LLVKDONJSA-N |
| XLogP | 1.93 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |