C24H32N4O4 — CID 58495045
tert-butyl 5-methyl-4-(2-pyrazin-2-yloxyethyl)-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate (PubChem CID 58495045) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is tert-butyl 5-methyl-4-(2-pyrazin-2-yloxyethyl)-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate.
| Compound Name | tert-butyl 5-methyl-4-(2-pyrazin-2-yloxyethyl)-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate |
|---|---|
| PubChem CID | 58495045 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | tert-butyl 5-methyl-4-(2-pyrazin-2-yloxyethyl)-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate |
| SMILES | Cc1c2c(cc3c1N(CCOc1cnccn1)CCO3)CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C24H32N4O4/c1-17-19-6-10-28(23(29)32-24(2,3)4)9-5-18(19)15-20-22(17)27(11-13-30-20)12-14-31-21-16-25-7-8-26-21/h7-8,15-16H,5-6,9-14H2,1-4H3 |
| InChIKey | CKZBYTACTLJZPO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |