C21H22F2N2O3 — CID 58495079
4-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-5-methyl-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine (PubChem CID 58495079) has the molecular formula C21H22F2N2O3 and a molecular weight of 388.41 g/mol. Its IUPAC name is 4-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-5-methyl-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine.
| Compound Name | 4-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-5-methyl-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine |
|---|---|
| PubChem CID | 58495079 |
| Molecular Formula | C21H22F2N2O3 |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 4-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-5-methyl-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine |
| SMILES | Cc1c2c(cc3c1N(Cc1ccc4c(c1)OC(F)(F)O4)CCO3)CCNCC2 |
| InChI | InChI=1S/C21H22F2N2O3/c1-13-16-5-7-24-6-4-15(16)11-19-20(13)25(8-9-26-19)12-14-2-3-17-18(10-14)28-21(22,23)27-17/h2-3,10-11,24H,4-9,12H2,1H3 |
| InChIKey | FFVKHCVKXAITKQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |