C16H22N2O2 — CID 58495172
1-(2-methoxyethyl)-4,6,7,8,9,10-hexahydro-3H-pyrido[2,3-h][3]benzazepin-2-one (PubChem CID 58495172) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-4,6,7,8,9,10-hexahydro-3H-pyrido[2,3-h][3]benzazepin-2-one.
| Compound Name | 1-(2-methoxyethyl)-4,6,7,8,9,10-hexahydro-3H-pyrido[2,3-h][3]benzazepin-2-one |
|---|---|
| PubChem CID | 58495172 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-(2-methoxyethyl)-4,6,7,8,9,10-hexahydro-3H-pyrido[2,3-h][3]benzazepin-2-one |
| SMILES | COCCN1C(=O)CCc2cc3c(cc21)CCNCC3 |
| InChI | InChI=1S/C16H22N2O2/c1-20-9-8-18-15-11-13-5-7-17-6-4-12(13)10-14(15)2-3-16(18)19/h10-11,17H,2-9H2,1H3 |
| InChIKey | LWIRCCVEMHSKQK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |