C19H27FN2O — CID 58495292
(3S)-5-cyclopropyl-4-(3-fluoropropyl)-3-methyl-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine (PubChem CID 58495292) has the molecular formula C19H27FN2O and a molecular weight of 318.44 g/mol. Its IUPAC name is (3S)-5-cyclopropyl-4-(3-fluoropropyl)-3-methyl-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine.
| Compound Name | (3S)-5-cyclopropyl-4-(3-fluoropropyl)-3-methyl-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine |
|---|---|
| PubChem CID | 58495292 |
| Molecular Formula | C19H27FN2O |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | (3S)-5-cyclopropyl-4-(3-fluoropropyl)-3-methyl-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine |
| SMILES | C[C@H]1COc2cc3c(c(C4CC4)c2N1CCCF)CCNCC3 |
| InChI | InChI=1S/C19H27FN2O/c1-13-12-23-17-11-15-5-8-21-9-6-16(15)18(14-3-4-14)19(17)22(13)10-2-7-20/h11,13-14,21H,2-10,12H2,1H3/t13-/m0/s1 |
| InChIKey | KDIBFFUXEUYVDE-ZDUSSCGKSA-N |
| XLogP | 3.20 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |