C18H21N3O — CID 58495316
4-(pyridin-2-ylmethyl)-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine (PubChem CID 58495316) has the molecular formula C18H21N3O and a molecular weight of 295.39 g/mol. Its IUPAC name is 4-(pyridin-2-ylmethyl)-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine.
| Compound Name | 4-(pyridin-2-ylmethyl)-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine |
|---|---|
| PubChem CID | 58495316 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 4-(pyridin-2-ylmethyl)-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine |
| SMILES | c1ccc(CN2CCOc3cc4c(cc32)CCNCC4)nc1 |
| InChI | InChI=1S/C18H21N3O/c1-2-6-20-16(3-1)13-21-9-10-22-18-12-15-5-8-19-7-4-14(15)11-17(18)21/h1-3,6,11-12,19H,4-5,7-10,13H2 |
| InChIKey | SXHUJPKEYGQCSI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |