C21H26N2O — CID 58495350
11-(3-methoxyphenyl)-1-methyl-2,3,4,6,7,8,9,10-octahydropyrido[3,2-h][3]benzazepine (PubChem CID 58495350) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is 11-(3-methoxyphenyl)-1-methyl-2,3,4,6,7,8,9,10-octahydropyrido[3,2-h][3]benzazepine.
| Compound Name | 11-(3-methoxyphenyl)-1-methyl-2,3,4,6,7,8,9,10-octahydropyrido[3,2-h][3]benzazepine |
|---|---|
| PubChem CID | 58495350 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 11-(3-methoxyphenyl)-1-methyl-2,3,4,6,7,8,9,10-octahydropyrido[3,2-h][3]benzazepine |
| SMILES | COc1cccc(-c2c3c(cc4c2N(C)CCC4)CCNCC3)c1 |
| InChI | InChI=1S/C21H26N2O/c1-23-12-4-6-17-13-15-8-10-22-11-9-19(15)20(21(17)23)16-5-3-7-18(14-16)24-2/h3,5,7,13-14,22H,4,6,8-12H2,1-2H3 |
| InChIKey | VBRIQYANLTYKOE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |