About [(2R)-1,1,1-trifluoropropan-2-yl]thiourea
[(2R)-1,1,1-trifluoropropan-2-yl]thiourea (PubChem CID 58495653) has the molecular formula C4H7F3N2S
and a molecular weight of 172.18 g/mol. Its IUPAC name is [(2R)-1,1,1-trifluoropropan-2-yl]thiourea.
Molecular Properties
| Compound Name | [(2R)-1,1,1-trifluoropropan-2-yl]thiourea |
| PubChem CID | 58495653 |
| Molecular Formula | C4H7F3N2S |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | [(2R)-1,1,1-trifluoropropan-2-yl]thiourea |
| SMILES | C[C@@H](NC(N)=S)C(F)(F)F |
| InChI | InChI=1S/C4H7F3N2S/c1-2(4(5,6)7)9-3(8)10/h2H,1H3,(H3,8,9,10)/t2-/m1/s1 |
| InChIKey | GPBHTWMEMJZOSM-UWTATZPHSA-N |
| XLogP | 0.77 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-1,1,1-trifluoropropan-2-yl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1,1,1-trifluoropropan-2-yl]thiourea?
The IUPAC name of [(2R)-1,1,1-trifluoropropan-2-yl]thiourea (CID 58495653) is [(2R)-1,1,1-trifluoropropan-2-yl]thiourea.
What is the SMILES notation for [(2R)-1,1,1-trifluoropropan-2-yl]thiourea?
The canonical SMILES for [(2R)-1,1,1-trifluoropropan-2-yl]thiourea is C[C@@H](NC(N)=S)C(F)(F)F.
What is the InChIKey of [(2R)-1,1,1-trifluoropropan-2-yl]thiourea?
The InChIKey is GPBHTWMEMJZOSM-UWTATZPHSA-N. The full InChI is InChI=1S/C4H7F3N2S/c1-2(4(5,6)7)9-3(8)10/h2H,1H3,(H3,8,9,10)/t2-/m1/s1.
What are the key properties of [(2R)-1,1,1-trifluoropropan-2-yl]thiourea?
[(2R)-1,1,1-trifluoropropan-2-yl]thiourea has a molecular weight of 172.18 g/mol, XLogP of 0.77, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1,1,1-trifluoropropan-2-yl]thiourea is sourced from PubChem (CID 58495653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).