C22H19ClFN3O4 — CID 58496405
2-(2-chloro-4-fluorophenyl)-5-[(3,5-dimethoxyphenyl)methyl]-4-methyl-1H-pyrazolo[4,3-c]pyridine-3,6-dione (PubChem CID 58496405) has the molecular formula C22H19ClFN3O4 and a molecular weight of 443.86 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenyl)-5-[(3,5-dimethoxyphenyl)methyl]-4-methyl-1H-pyrazolo[4,3-c]pyridine-3,6-dione.
| Compound Name | 2-(2-chloro-4-fluorophenyl)-5-[(3,5-dimethoxyphenyl)methyl]-4-methyl-1H-pyrazolo[4,3-c]pyridine-3,6-dione |
|---|---|
| PubChem CID | 58496405 |
| Molecular Formula | C22H19ClFN3O4 |
| Molecular Weight | 443.86 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 2-(2-chloro-4-fluorophenyl)-5-[(3,5-dimethoxyphenyl)methyl]-4-methyl-1H-pyrazolo[4,3-c]pyridine-3,6-dione |
| SMILES | COc1cc(Cn2c(C)c3c(=O)n(-c4ccc(F)cc4Cl)[nH]c3cc2=O)cc(OC)c1 |
| InChI | InChI=1S/C22H19ClFN3O4/c1-12-21-18(25-27(22(21)29)19-5-4-14(24)8-17(19)23)10-20(28)26(12)11-13-6-15(30-2)9-16(7-13)31-3/h4-10,25H,11H2,1-3H3 |
| InChIKey | MBMQOXVZIYKHMG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.86 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|