C23H26F3NO3 — CID 58497107
benzyl (6R)-6-(3,4-dimethylphenyl)-6-[(2,2,2-trifluoroacetyl)amino]hexanoate (PubChem CID 58497107) has the molecular formula C23H26F3NO3 and a molecular weight of 421.46 g/mol. Its IUPAC name is benzyl (6R)-6-(3,4-dimethylphenyl)-6-[(2,2,2-trifluoroacetyl)amino]hexanoate.
| Compound Name | benzyl (6R)-6-(3,4-dimethylphenyl)-6-[(2,2,2-trifluoroacetyl)amino]hexanoate |
|---|---|
| PubChem CID | 58497107 |
| Molecular Formula | C23H26F3NO3 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | benzyl (6R)-6-(3,4-dimethylphenyl)-6-[(2,2,2-trifluoroacetyl)amino]hexanoate |
| SMILES | Cc1ccc([C@@H](CCCCC(=O)OCc2ccccc2)NC(=O)C(F)(F)F)cc1C |
| InChI | InChI=1S/C23H26F3NO3/c1-16-12-13-19(14-17(16)2)20(27-22(29)23(24,25)26)10-6-7-11-21(28)30-15-18-8-4-3-5-9-18/h3-5,8-9,12-14,20H,6-7,10-11,15H2,1-2H3,(H,27,29)/t20-/m1/s1 |
| InChIKey | JIEVGQDMSAKJGC-HXUWFJFHSA-N |
| XLogP | 5.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|