C33H39F2N3O4 — CID 58497136
2-[(1R)-4-[(2,6-difluorophenyl)methoxy]-1-(3,4-dimethoxyphenyl)butyl]-4-[4-(methylamino)piperidin-1-yl]-3H-isoindol-1-one (PubChem CID 58497136) has the molecular formula C33H39F2N3O4 and a molecular weight of 579.69 g/mol. Its IUPAC name is 2-[(1R)-4-[(2,6-difluorophenyl)methoxy]-1-(3,4-dimethoxyphenyl)butyl]-4-[4-(methylamino)piperidin-1-yl]-3H-isoindol-1-one.
| Compound Name | 2-[(1R)-4-[(2,6-difluorophenyl)methoxy]-1-(3,4-dimethoxyphenyl)butyl]-4-[4-(methylamino)piperidin-1-yl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 58497136 |
| Molecular Formula | C33H39F2N3O4 |
| Molecular Weight | 579.69 g/mol |
| Exact Mass | 579.29 |
| IUPAC Name | 2-[(1R)-4-[(2,6-difluorophenyl)methoxy]-1-(3,4-dimethoxyphenyl)butyl]-4-[4-(methylamino)piperidin-1-yl]-3H-isoindol-1-one |
| SMILES | CNC1CCN(c2cccc3c2CN([C@H](CCCOCc2c(F)cccc2F)c2ccc(OC)c(OC)c2)C3=O)CC1 |
| InChI | InChI=1S/C33H39F2N3O4/c1-36-23-14-16-37(17-15-23)30-10-4-7-24-25(30)20-38(33(24)39)29(22-12-13-31(40-2)32(19-22)41-3)11-6-18-42-21-26-27(34)8-5-9-28(26)35/h4-5,7-10,12-13,19,23,29,36H,6,11,14-18,20-21H2,1-3H3/t29-/m1/s1 |
| InChIKey | ZBISQZLQVCJQOJ-GDLZYMKVSA-N |
| XLogP | 5.86 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.69 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|