C27H36N7O3+ — CID 58497153
2-[(1R)-1-(3,4-dimethoxyphenyl)-4-(2H-tetrazol-1-ium-1-yl)butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one (PubChem CID 58497153) has the molecular formula C27H36N7O3+ and a molecular weight of 506.63 g/mol. Its IUPAC name is 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-(2H-tetrazol-1-ium-1-yl)butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one.
| Compound Name | 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-(2H-tetrazol-1-ium-1-yl)butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 58497153 |
| Molecular Formula | C27H36N7O3+ |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-(2H-tetrazol-1-ium-1-yl)butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one |
| SMILES | CCN1CCN(c2cccc3c2CN([C@H](CCC[n+]2cnn[nH]2)c2ccc(OC)c(OC)c2)C3=O)CC1 |
| InChI | InChI=1S/C27H35N7O3/c1-4-31-13-15-32(16-14-31)24-8-5-7-21-22(24)18-34(27(21)35)23(9-6-12-33-19-28-29-30-33)20-10-11-25(36-2)26(17-20)37-3/h5,7-8,10-11,17,19,23H,4,6,9,12-16,18H2,1-3H3/p+1/t23-/m1/s1 |
| InChIKey | BLLKULYJBMAVNM-HSZRJFAPSA-O |
| XLogP | 2.43 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|